C28H40O6SSi — CID 11642284
[(1S,2R,3S,4R,5S)-4-ethenyl-3-(methoxymethoxy)-2-(methoxymethoxymethyl)-5-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]-dimethyl-phenylsilane (PubChem CID 11642284) has the molecular formula C28H40O6SSi and a molecular weight of 532.78 g/mol. Its IUPAC name is [(1S,2R,3S,4R,5S)-4-ethenyl-3-(methoxymethoxy)-2-(methoxymethoxymethyl)-5-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]-dimethyl-phenylsilane.
| Compound Name | [(1S,2R,3S,4R,5S)-4-ethenyl-3-(methoxymethoxy)-2-(methoxymethoxymethyl)-5-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 11642284 |
| Molecular Formula | C28H40O6SSi |
| Molecular Weight | 532.78 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | [(1S,2R,3S,4R,5S)-4-ethenyl-3-(methoxymethoxy)-2-(methoxymethoxymethyl)-5-[(4-methylphenyl)sulfonylmethyl]cyclopentyl]-dimethyl-phenylsilane |
| SMILES | C=C[C@@H]1[C@H](CS(=O)(=O)c2ccc(C)cc2)[C@@H]([Si](C)(C)c2ccccc2)[C@H](COCOC)[C@H]1OCOC |
| InChI | InChI=1S/C28H40O6SSi/c1-7-24-26(18-35(29,30)22-15-13-21(2)14-16-22)28(36(5,6)23-11-9-8-10-12-23)25(17-33-19-31-3)27(24)34-20-32-4/h7-16,24-28H,1,17-20H2,2-6H3/t24-,25-,26+,27+,28+/m1/s1 |
| InChIKey | GBSCHWUJYMNYOE-MASCHLQQSA-N |
| XLogP | 4.41 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.78 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|