C10H15ClN4O2 — CID 116510657
1-amino-3-(5-chloro-2,4-dimethoxyphenyl)-2-methylguanidine (PubChem CID 116510657) has the molecular formula C10H15ClN4O2 and a molecular weight of 258.71 g/mol. Its IUPAC name is 1-amino-3-(5-chloro-2,4-dimethoxyphenyl)-2-methylguanidine.
| Compound Name | 1-amino-3-(5-chloro-2,4-dimethoxyphenyl)-2-methylguanidine |
|---|---|
| PubChem CID | 116510657 |
| Molecular Formula | C10H15ClN4O2 |
| Molecular Weight | 258.71 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 1-amino-3-(5-chloro-2,4-dimethoxyphenyl)-2-methylguanidine |
| SMILES | C/N=C(\NN)Nc1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C10H15ClN4O2/c1-13-10(15-12)14-7-4-6(11)8(16-2)5-9(7)17-3/h4-5H,12H2,1-3H3,(H2,13,14,15) |
| InChIKey | IVPLHNFGNKRMKF-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.71 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|