C11H10ClF3O2S — CID 117267958
(Z)-4-[4-(trifluoromethyl)phenyl]but-2-ene-1-sulfonyl chloride (PubChem CID 117267958) has the molecular formula C11H10ClF3O2S and a molecular weight of 298.71 g/mol. Its IUPAC name is (Z)-4-[4-(trifluoromethyl)phenyl]but-2-ene-1-sulfonyl chloride.
| Compound Name | (Z)-4-[4-(trifluoromethyl)phenyl]but-2-ene-1-sulfonyl chloride |
|---|---|
| PubChem CID | 117267958 |
| Molecular Formula | C11H10ClF3O2S |
| Molecular Weight | 298.71 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | (Z)-4-[4-(trifluoromethyl)phenyl]but-2-ene-1-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)C/C=C\Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H10ClF3O2S/c12-18(16,17)8-2-1-3-9-4-6-10(7-5-9)11(13,14)15/h1-2,4-7H,3,8H2/b2-1- |
| InChIKey | FFBIVFKBBDETOJ-UPHRSURJSA-N |
| XLogP | 3.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.71 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|