C33H34N4O9Si — CID 11734981
1-[(3aR,4R,6R,6aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[(2-nitrophenyl)methoxy]-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-4-yl]pyrimidine-2,4-dione (PubChem CID 11734981) has the molecular formula C33H34N4O9Si and a molecular weight of 658.74 g/mol. Its IUPAC name is 1-[(3aR,4R,6R,6aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[(2-nitrophenyl)methoxy]-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-4-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(3aR,4R,6R,6aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[(2-nitrophenyl)methoxy]-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-4-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11734981 |
| Molecular Formula | C33H34N4O9Si |
| Molecular Weight | 658.74 g/mol |
| Exact Mass | 658.21 |
| IUPAC Name | 1-[(3aR,4R,6R,6aS)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-[(2-nitrophenyl)methoxy]-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazol-4-yl]pyrimidine-2,4-dione |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)[C@H]2[C@@H]1OC(=O)N2OCc1ccccc1[N+](=O)[O-])(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H34N4O9Si/c1-33(2,3)47(23-13-6-4-7-14-23,24-15-8-5-9-16-24)44-21-26-29-28(30(45-26)35-19-18-27(38)34-31(35)39)36(32(40)46-29)43-20-22-12-10-11-17-25(22)37(41)42/h4-19,26,28-30H,20-21H2,1-3H3,(H,34,38,39)/t26-,28-,29-,30-/m1/s1 |
| InChIKey | ZVEFASLQGALTQD-PYYPWFDZSA-N |
| XLogP | 3.24 |
| TPSA | 155.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.74 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|