C31H34N4O2Zn — CID 11766886
zinc methyl 3-[(4Z,14Z)-8,12-diethyl-3,7,13-trimethyl-10,20-dihydroporphyrin-22,24-diid-2-yl]propanoate (PubChem CID 11766886) has the molecular formula C31H34N4O2Zn and a molecular weight of 560.03 g/mol. Its IUPAC name is zinc methyl 3-[(4Z,14Z)-8,12-diethyl-3,7,13-trimethyl-10,20-dihydroporphyrin-22,24-diid-2-yl]propanoate.
| Compound Name | zinc methyl 3-[(4Z,14Z)-8,12-diethyl-3,7,13-trimethyl-10,20-dihydroporphyrin-22,24-diid-2-yl]propanoate |
|---|---|
| PubChem CID | 11766886 |
| Molecular Formula | C31H34N4O2Zn |
| Molecular Weight | 560.03 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | zinc methyl 3-[(4Z,14Z)-8,12-diethyl-3,7,13-trimethyl-10,20-dihydroporphyrin-22,24-diid-2-yl]propanoate |
| SMILES | CCC1=C(C)/C2=C/c3ccc([n-]3)CC3=N/C(=C\c4[n-]c(c(CC)c4C)CC1=N2)C(C)=C3CCC(=O)OC.[Zn+2] |
| InChI | InChI=1S/C31H34N4O2.Zn/c1-7-22-17(3)25-13-20-9-10-21(32-20)14-28-24(11-12-31(36)37-6)19(5)27(34-28)15-26-18(4)23(8-2)30(35-26)16-29(22)33-25;/h9-10,13,15H,7-8,11-12,14,16H2,1-6H3;/q-2;+2 |
| InChIKey | VLAGRDGTYBFFBL-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 79.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.03 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|