C24H25N5O4 — CID 121239054
5-[(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-pyridin-3-ylmethyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 121239054) has the molecular formula C24H25N5O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is 5-[(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-pyridin-3-ylmethyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-pyridin-3-ylmethyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 121239054 |
| Molecular Formula | C24H25N5O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | 5-[(1-benzyl-4,5-dimethyl-3-oxidoimidazol-3-ium-2-yl)-pyridin-3-ylmethyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1c(C)[n+]([O-])c(C(c2cccnc2)C2C(=O)N(C)C(=O)N(C)C2=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C24H25N5O4/c1-15-16(2)29(33)21(28(15)14-17-9-6-5-7-10-17)19(18-11-8-12-25-13-18)20-22(30)26(3)24(32)27(4)23(20)31/h5-13,19-20H,14H2,1-4H3 |
| InChIKey | DWNJHGMASYCEME-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|