C8H12F8Si — CID 123141383
methyl(3,3,4,4,5,5,6,6-octafluoroheptyl)silane (PubChem CID 123141383) has the molecular formula C8H12F8Si and a molecular weight of 288.25 g/mol. Its IUPAC name is methyl(3,3,4,4,5,5,6,6-octafluoroheptyl)silane.
| Compound Name | methyl(3,3,4,4,5,5,6,6-octafluoroheptyl)silane |
|---|---|
| PubChem CID | 123141383 |
| Molecular Formula | C8H12F8Si |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | methyl(3,3,4,4,5,5,6,6-octafluoroheptyl)silane |
| SMILES | C[SiH2]CCC(F)(F)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C8H12F8Si/c1-5(9,10)7(13,14)8(15,16)6(11,12)3-4-17-2/h3-4,17H2,1-2H3 |
| InChIKey | ZJBINNVQQJKSTJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|