C22H36O6 — CID 123183159
4-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxycarbonyl)-2,3-diethyl-2,3-di(propan-2-yl)cyclobutane-1-carboxylic acid (PubChem CID 123183159) has the molecular formula C22H36O6 and a molecular weight of 396.52 g/mol. Its IUPAC name is 4-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxycarbonyl)-2,3-diethyl-2,3-di(propan-2-yl)cyclobutane-1-carboxylic acid.
| Compound Name | 4-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxycarbonyl)-2,3-diethyl-2,3-di(propan-2-yl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 123183159 |
| Molecular Formula | C22H36O6 |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 4-(2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yloxycarbonyl)-2,3-diethyl-2,3-di(propan-2-yl)cyclobutane-1-carboxylic acid |
| SMILES | CCC1(C(C)C)C(C(=O)O)C(C(=O)OC2COC3CCOC32)C1(CC)C(C)C |
| InChI | InChI=1S/C22H36O6/c1-7-21(12(3)4)16(19(23)24)17(22(21,8-2)13(5)6)20(25)28-15-11-27-14-9-10-26-18(14)15/h12-18H,7-11H2,1-6H3,(H,23,24) |
| InChIKey | IVCYYFCHNIUTFE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |