C18H11N3O4S2 — CID 124577292
(2Z,4R)-5-imino-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one (PubChem CID 124577292) has the molecular formula C18H11N3O4S2 and a molecular weight of 397.44 g/mol. Its IUPAC name is (2Z,4R)-5-imino-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one.
| Compound Name | (2Z,4R)-5-imino-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one |
|---|---|
| PubChem CID | 124577292 |
| Molecular Formula | C18H11N3O4S2 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | (2Z,4R)-5-imino-2-[[5-(3-nitrophenyl)furan-2-yl]methylidene]-4-(1,3-thiazol-2-yl)thiolan-3-one |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(-c3cccc([N+](=O)[O-])c3)o2)C(=O)[C@H]1c1nccs1 |
| InChI | InChI=1S/C18H11N3O4S2/c19-17-15(18-20-6-7-26-18)16(22)14(27-17)9-12-4-5-13(25-12)10-2-1-3-11(8-10)21(23)24/h1-9,15,19H/b14-9-,19-17-/t15-/m1/s1 |
| InChIKey | UZFQOAVPARKGHN-UCYLSPMPSA-N |
| XLogP | 4.73 |
| TPSA | 110.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|