C19H12N2O4S2 — CID 124576358
2-[5-[(Z)-[(4R)-5-imino-3-oxo-4-(1,3-thiazol-2-yl)thiolan-2-ylidene]methyl]furan-2-yl]benzoic acid (PubChem CID 124576358) has the molecular formula C19H12N2O4S2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-[5-[(Z)-[(4R)-5-imino-3-oxo-4-(1,3-thiazol-2-yl)thiolan-2-ylidene]methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-[5-[(Z)-[(4R)-5-imino-3-oxo-4-(1,3-thiazol-2-yl)thiolan-2-ylidene]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 124576358 |
| Molecular Formula | C19H12N2O4S2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | 2-[5-[(Z)-[(4R)-5-imino-3-oxo-4-(1,3-thiazol-2-yl)thiolan-2-ylidene]methyl]furan-2-yl]benzoic acid |
| SMILES | [H]/N=C1\S/C(=C\c2ccc(-c3ccccc3C(=O)O)o2)C(=O)[C@H]1c1nccs1 |
| InChI | InChI=1S/C19H12N2O4S2/c20-17-15(18-21-7-8-26-18)16(22)14(27-17)9-10-5-6-13(25-10)11-3-1-2-4-12(11)19(23)24/h1-9,15,20H,(H,23,24)/b14-9-,20-17-/t15-/m1/s1 |
| InChIKey | QGMYJOGSBRLPAD-ZFMCRBKNSA-N |
| XLogP | 4.52 |
| TPSA | 104.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|