About 6-(2,5-dioxopyrrol-1-yl)-N-[(E)-2-(methyldisulfanyl)ethylideneamino]hexanamide
6-(2,5-dioxopyrrol-1-yl)-N-[(E)-2-(methyldisulfanyl)ethylideneamino]hexanamide (PubChem CID 126759100) has the molecular formula C13H19N3O3S2
and a molecular weight of 329.45 g/mol. Its IUPAC name is 6-(2,5-dioxopyrrol-1-yl)-N-[(E)-2-(methyldisulfanyl)ethylideneamino]hexanamide.
Molecular Properties
| Compound Name | 6-(2,5-dioxopyrrol-1-yl)-N-[(E)-2-(methyldisulfanyl)ethylideneamino]hexanamide |
| PubChem CID | 126759100 |
| Molecular Formula | C13H19N3O3S2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 6-(2,5-dioxopyrrol-1-yl)-N-[(E)-2-(methyldisulfanyl)ethylideneamino]hexanamide |
| SMILES | CSSC/C=N/NC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C13H19N3O3S2/c1-20-21-10-8-14-15-11(17)5-3-2-4-9-16-12(18)6-7-13(16)19/h6-8H,2-5,9-10H2,1H3,(H,15,17)/b14-8+ |
| InChIKey | MUKKXZQCFCCPOE-RIYZIHGNSA-N |
| XLogP | 1.59 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 6-(2,5-dioxopyrrol-1-yl)-N-[(E)-2-(methyldisulfanyl)ethylideneamino]hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,5-dioxopyrrol-1-yl)-N-[(E)-2-(methyldisulfanyl)ethylideneamino]hexanamide?
The IUPAC name of 6-(2,5-dioxopyrrol-1-yl)-N-[(E)-2-(methyldisulfanyl)ethylideneamino]hexanamide (CID 126759100) is 6-(2,5-dioxopyrrol-1-yl)-N-[(E)-2-(methyldisulfanyl)ethylideneamino]hexanamide.
What is the SMILES notation for 6-(2,5-dioxopyrrol-1-yl)-N-[(E)-2-(methyldisulfanyl)ethylideneamino]hexanamide?
The canonical SMILES for 6-(2,5-dioxopyrrol-1-yl)-N-[(E)-2-(methyldisulfanyl)ethylideneamino]hexanamide is CSSC/C=N/NC(=O)CCCCCN1C(=O)C=CC1=O.
What is the InChIKey of 6-(2,5-dioxopyrrol-1-yl)-N-[(E)-2-(methyldisulfanyl)ethylideneamino]hexanamide?
The InChIKey is MUKKXZQCFCCPOE-RIYZIHGNSA-N. The full InChI is InChI=1S/C13H19N3O3S2/c1-20-21-10-8-14-15-11(17)5-3-2-4-9-16-12(18)6-7-13(16)19/h6-8H,2-5,9-10H2,1H3,(H,15,17)/b14-8+.
What are the key properties of 6-(2,5-dioxopyrrol-1-yl)-N-[(E)-2-(methyldisulfanyl)ethylideneamino]hexanamide?
6-(2,5-dioxopyrrol-1-yl)-N-[(E)-2-(methyldisulfanyl)ethylideneamino]hexanamide has a molecular weight of 329.45 g/mol, XLogP of 1.59, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dioxopyrrol-1-yl)-N-[(E)-2-(methyldisulfanyl)ethylideneamino]hexanamide is sourced from PubChem (CID 126759100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).