C5H4I3N — CID 129082853
1,2,5-triiodo-3-methylpyrrole (PubChem CID 129082853) has the molecular formula C5H4I3N and a molecular weight of 458.81 g/mol. Its IUPAC name is 1,2,5-triiodo-3-methylpyrrole.
| Compound Name | 1,2,5-triiodo-3-methylpyrrole |
|---|---|
| PubChem CID | 129082853 |
| Molecular Formula | C5H4I3N |
| Molecular Weight | 458.81 g/mol |
| Exact Mass | 458.75 |
| IUPAC Name | 1,2,5-triiodo-3-methylpyrrole |
| SMILES | Cc1cc(I)n(I)c1I |
| InChI | InChI=1S/C5H4I3N/c1-3-2-4(6)9(8)5(3)7/h2H,1H3 |
| InChIKey | PPYILPYUTINDTR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.81 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|