C34H65N5O3Si2Sn — CID 12994316
9-[(2R,3R,4S,5Z)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(tributylstannylmethylidene)oxolan-2-yl]purin-6-amine (PubChem CID 12994316) has the molecular formula C34H65N5O3Si2Sn and a molecular weight of 766.81 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5Z)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(tributylstannylmethylidene)oxolan-2-yl]purin-6-amine.
| Compound Name | 9-[(2R,3R,4S,5Z)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(tributylstannylmethylidene)oxolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 12994316 |
| Molecular Formula | C34H65N5O3Si2Sn |
| Molecular Weight | 766.81 g/mol |
| Exact Mass | 767.36 |
| IUPAC Name | 9-[(2R,3R,4S,5Z)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(tributylstannylmethylidene)oxolan-2-yl]purin-6-amine |
| SMILES | CCCC[Sn](/C=C1\O[C@@H](n2cnc3c(N)ncnc32)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C22H38N5O3Si2.3C4H9.Sn/c1-14-16(29-31(8,9)21(2,3)4)17(30-32(10,11)22(5,6)7)20(28-14)27-13-26-15-18(23)24-12-25-19(15)27;3*1-3-4-2;/h1,12-13,16-17,20H,2-11H3,(H2,23,24,25);3*1,3-4H2,2H3;/t16-,17-,20-;;;;/m1..../s1 |
| InChIKey | OKJWGCYZBPZPCV-VGJFASETSA-N |
| XLogP | 9.99 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.81 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|