C18H19N3OS — CID 13001782
N-[3-(2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]cyclohexa-1,4-diene-1-carboxamide (PubChem CID 13001782) has the molecular formula C18H19N3OS and a molecular weight of 325.44 g/mol. Its IUPAC name is N-[3-(2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]cyclohexa-1,4-diene-1-carboxamide.
| Compound Name | N-[3-(2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]cyclohexa-1,4-diene-1-carboxamide |
|---|---|
| PubChem CID | 13001782 |
| Molecular Formula | C18H19N3OS |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | N-[3-(2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-6-yl)phenyl]cyclohexa-1,4-diene-1-carboxamide |
| SMILES | O=C(Nc1cccc(C2CN3CCSC3=N2)c1)C1=CCC=CC1 |
| InChI | InChI=1S/C18H19N3OS/c22-17(13-5-2-1-3-6-13)19-15-8-4-7-14(11-15)16-12-21-9-10-23-18(21)20-16/h1-2,4,6-8,11,16H,3,5,9-10,12H2,(H,19,22) |
| InChIKey | SDTSCHSDQOQCKU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|