C18H29NO6 — CID 130384639
(2R)-3-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-4-methyl-1-nitropentan-2-ol (PubChem CID 130384639) has the molecular formula C18H29NO6 and a molecular weight of 355.43 g/mol. Its IUPAC name is (2R)-3-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-4-methyl-1-nitropentan-2-ol.
| Compound Name | (2R)-3-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-4-methyl-1-nitropentan-2-ol |
|---|---|
| PubChem CID | 130384639 |
| Molecular Formula | C18H29NO6 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | (2R)-3-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-4-methyl-1-nitropentan-2-ol |
| SMILES | COCCCOc1cc(CC(C(C)C)[C@@H](O)C[N+](=O)[O-])ccc1OC |
| InChI | InChI=1S/C18H29NO6/c1-13(2)15(16(20)12-19(21)22)10-14-6-7-17(24-4)18(11-14)25-9-5-8-23-3/h6-7,11,13,15-16,20H,5,8-10,12H2,1-4H3/t15?,16-/m0/s1 |
| InChIKey | WABGPSYEDVUNNI-LYKKTTPLSA-N |
| XLogP | 2.56 |
| TPSA | 91.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|