C12H12N3O10P — CID 130416779
tris(2,5-dioxopyrrolidin-1-yl) phosphate (PubChem CID 130416779) has the molecular formula C12H12N3O10P and a molecular weight of 389.21 g/mol. Its IUPAC name is tris(2,5-dioxopyrrolidin-1-yl) phosphate.
| Compound Name | tris(2,5-dioxopyrrolidin-1-yl) phosphate |
|---|---|
| PubChem CID | 130416779 |
| Molecular Formula | C12H12N3O10P |
| Molecular Weight | 389.21 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | tris(2,5-dioxopyrrolidin-1-yl) phosphate |
| SMILES | O=C1CCC(=O)N1OP(=O)(ON1C(=O)CCC1=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C12H12N3O10P/c16-7-1-2-8(17)13(7)23-26(22,24-14-9(18)3-4-10(14)19)25-15-11(20)5-6-12(15)21/h1-6H2 |
| InChIKey | RQXKRQQXSIXCHW-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 156.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.21 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|