C6H7FN2O3 — CID 131102028
N-(2-fluoroethyl)-3-oxo-1,2-oxazole-5-carboxamide (PubChem CID 131102028) has the molecular formula C6H7FN2O3 and a molecular weight of 174.13 g/mol. Its IUPAC name is N-(2-fluoroethyl)-3-oxo-1,2-oxazole-5-carboxamide.
| Compound Name | N-(2-fluoroethyl)-3-oxo-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 131102028 |
| Molecular Formula | C6H7FN2O3 |
| Molecular Weight | 174.13 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | N-(2-fluoroethyl)-3-oxo-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCCF)c1cc(=O)[nH]o1 |
| InChI | InChI=1S/C6H7FN2O3/c7-1-2-8-6(11)4-3-5(10)9-12-4/h3H,1-2H2,(H,8,11)(H,9,10) |
| InChIKey | MOIPZUVLKGFPBI-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 75.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.13 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |