C24H36FeOS — CID 131725752
cyclopenta-1,3-diene;S-(12-cyclopenta-1,4-dien-1-yldodecyl) ethanethioate;iron(2+) (PubChem CID 131725752) has the molecular formula C24H36FeOS and a molecular weight of 428.46 g/mol. Its IUPAC name is cyclopenta-1,3-diene;S-(12-cyclopenta-1,4-dien-1-yldodecyl) ethanethioate;iron(2+).
| Compound Name | cyclopenta-1,3-diene;S-(12-cyclopenta-1,4-dien-1-yldodecyl) ethanethioate;iron(2+) |
|---|---|
| PubChem CID | 131725752 |
| Molecular Formula | C24H36FeOS |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | cyclopenta-1,3-diene;S-(12-cyclopenta-1,4-dien-1-yldodecyl) ethanethioate;iron(2+) |
| SMILES | CC(=O)SCCCCCCCCCCCCc1cc[cH-]c1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C19H31OS.C5H5.Fe/c1-18(20)21-17-13-9-7-5-3-2-4-6-8-10-14-19-15-11-12-16-19;1-2-4-5-3-1;/h11-12,15-16H,2-10,13-14,17H2,1H3;1-5H;/q2*-1;+2 |
| InChIKey | QXZZNPRAPXMMFG-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|