C28H44FeOS — CID 131725753
cyclopenta-1,3-diene;S-(16-cyclopenta-1,4-dien-1-ylhexadecyl) ethanethioate;iron(2+) (PubChem CID 131725753) has the molecular formula C28H44FeOS and a molecular weight of 484.57 g/mol. Its IUPAC name is cyclopenta-1,3-diene;S-(16-cyclopenta-1,4-dien-1-ylhexadecyl) ethanethioate;iron(2+).
| Compound Name | cyclopenta-1,3-diene;S-(16-cyclopenta-1,4-dien-1-ylhexadecyl) ethanethioate;iron(2+) |
|---|---|
| PubChem CID | 131725753 |
| Molecular Formula | C28H44FeOS |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | cyclopenta-1,3-diene;S-(16-cyclopenta-1,4-dien-1-ylhexadecyl) ethanethioate;iron(2+) |
| SMILES | CC(=O)SCCCCCCCCCCCCCCCCc1cc[cH-]c1.[Fe+2].c1cc[cH-]c1 |
| InChI | InChI=1S/C23H39OS.C5H5.Fe/c1-22(24)25-21-17-13-11-9-7-5-3-2-4-6-8-10-12-14-18-23-19-15-16-20-23;1-2-4-5-3-1;/h15-16,19-20H,2-14,17-18,21H2,1H3;1-5H;/q2*-1;+2 |
| InChIKey | CSFQIUJUHWCYRY-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|