C31H49BO5Si — CID 132511446
2-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-enyl]-3-methylcyclohex-2-en-1-one (PubChem CID 132511446) has the molecular formula C31H49BO5Si and a molecular weight of 540.63 g/mol. Its IUPAC name is 2-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-enyl]-3-methylcyclohex-2-en-1-one.
| Compound Name | 2-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-enyl]-3-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 132511446 |
| Molecular Formula | C31H49BO5Si |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.34 |
| IUPAC Name | 2-[(E,1S)-1-[tert-butyl(dimethyl)silyl]oxy-5-phenylmethoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-3-enyl]-3-methylcyclohex-2-en-1-one |
| SMILES | CC1=C([C@H](C/C(=C/COCc2ccccc2)B2OC(C)(C)C(C)(C)O2)O[Si](C)(C)C(C)(C)C)C(=O)CCC1 |
| InChI | InChI=1S/C31H49BO5Si/c1-23-15-14-18-26(33)28(23)27(35-38(9,10)29(2,3)4)21-25(32-36-30(5,6)31(7,8)37-32)19-20-34-22-24-16-12-11-13-17-24/h11-13,16-17,19,27H,14-15,18,20-22H2,1-10H3/b25-19-/t27-/m0/s1 |
| InChIKey | RHZJGWRSHXOPLB-YWRNMLBISA-N |
| XLogP | 7.61 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|