C20H25N5O3 — CID 134231871
(5aS,9aS)-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2,6,9a-trimethyl-7-oxo-4,5,5a,6,8,9-hexahydrobenzo[g]indazole-8-carbonitrile (PubChem CID 134231871) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is (5aS,9aS)-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2,6,9a-trimethyl-7-oxo-4,5,5a,6,8,9-hexahydrobenzo[g]indazole-8-carbonitrile.
| Compound Name | (5aS,9aS)-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2,6,9a-trimethyl-7-oxo-4,5,5a,6,8,9-hexahydrobenzo[g]indazole-8-carbonitrile |
|---|---|
| PubChem CID | 134231871 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | (5aS,9aS)-3-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)-2,6,9a-trimethyl-7-oxo-4,5,5a,6,8,9-hexahydrobenzo[g]indazole-8-carbonitrile |
| SMILES | CC1C(=O)C(C#N)C[C@]2(C)c3nn(C)c(N4C(=O)NC(C)(C)C4=O)c3CC[C@@H]12 |
| InChI | InChI=1S/C20H25N5O3/c1-10-13-7-6-12-15(20(13,4)8-11(9-21)14(10)26)23-24(5)16(12)25-17(27)19(2,3)22-18(25)28/h10-11,13H,6-8H2,1-5H3,(H,22,28)/t10?,11?,13-,20-/m0/s1 |
| InChIKey | GEHHODFOELQTHJ-AHCZSFIKSA-N |
| XLogP | 1.82 |
| TPSA | 108.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|