C13H24O3 — CID 134502166
3-(2,4-dimethylpentoxymethyl)pentanedial (PubChem CID 134502166) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 3-(2,4-dimethylpentoxymethyl)pentanedial.
| Compound Name | 3-(2,4-dimethylpentoxymethyl)pentanedial |
|---|---|
| PubChem CID | 134502166 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 3-(2,4-dimethylpentoxymethyl)pentanedial |
| SMILES | CC(C)CC(C)COCC(CC=O)CC=O |
| InChI | InChI=1S/C13H24O3/c1-11(2)8-12(3)9-16-10-13(4-6-14)5-7-15/h6-7,11-13H,4-5,8-10H2,1-3H3 |
| InChIKey | NRXGHQGCWIBPPP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|