C41H68O4Si3 — CID 134831510
(5R,6Z,8Z,10E)-5-[tert-butyl(dimethyl)silyl]oxy-12-[tert-butyl(diphenyl)silyl]oxy-2-methyl-2-triethylsilyloxydodeca-6,8,10-trien-3-ol (PubChem CID 134831510) has the molecular formula C41H68O4Si3 and a molecular weight of 709.25 g/mol. Its IUPAC name is (5R,6Z,8Z,10E)-5-[tert-butyl(dimethyl)silyl]oxy-12-[tert-butyl(diphenyl)silyl]oxy-2-methyl-2-triethylsilyloxydodeca-6,8,10-trien-3-ol.
| Compound Name | (5R,6Z,8Z,10E)-5-[tert-butyl(dimethyl)silyl]oxy-12-[tert-butyl(diphenyl)silyl]oxy-2-methyl-2-triethylsilyloxydodeca-6,8,10-trien-3-ol |
|---|---|
| PubChem CID | 134831510 |
| Molecular Formula | C41H68O4Si3 |
| Molecular Weight | 709.25 g/mol |
| Exact Mass | 708.44 |
| IUPAC Name | (5R,6Z,8Z,10E)-5-[tert-butyl(dimethyl)silyl]oxy-12-[tert-butyl(diphenyl)silyl]oxy-2-methyl-2-triethylsilyloxydodeca-6,8,10-trien-3-ol |
| SMILES | CC[Si](CC)(CC)OC(C)(C)C(O)C[C@H](/C=C\C=C/C=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C41H68O4Si3/c1-14-47(15-2,16-3)45-41(10,11)38(42)34-35(44-46(12,13)39(4,5)6)28-22-18-17-19-27-33-43-48(40(7,8)9,36-29-23-20-24-30-36)37-31-25-21-26-32-37/h17-32,35,38,42H,14-16,33-34H2,1-13H3/b18-17-,27-19+,28-22-/t35-,38?/m0/s1 |
| InChIKey | TZXCXKOQCLOFRB-RBGMNUDUSA-N |
| XLogP | 10.17 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.25 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|