C16H26F2 — CID 134969750
6,6-difluoro-3,3,4,4a,7,8-hexamethyl-2,4,5,8a-tetrahydro-1H-naphthalene (PubChem CID 134969750) has the molecular formula C16H26F2 and a molecular weight of 256.38 g/mol. Its IUPAC name is 6,6-difluoro-3,3,4,4a,7,8-hexamethyl-2,4,5,8a-tetrahydro-1H-naphthalene.
| Compound Name | 6,6-difluoro-3,3,4,4a,7,8-hexamethyl-2,4,5,8a-tetrahydro-1H-naphthalene |
|---|---|
| PubChem CID | 134969750 |
| Molecular Formula | C16H26F2 |
| Molecular Weight | 256.38 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 6,6-difluoro-3,3,4,4a,7,8-hexamethyl-2,4,5,8a-tetrahydro-1H-naphthalene |
| SMILES | CC1=C(C)C(F)(F)CC2(C)C1CCC(C)(C)C2C |
| InChI | InChI=1S/C16H26F2/c1-10-11(2)16(17,18)9-15(6)12(3)14(4,5)8-7-13(10)15/h12-13H,7-9H2,1-6H3 |
| InChIKey | RLIPTVMOVZSPGZ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.38 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|