C28H20N6O3S2 — CID 135428438
2-[5-(1,3-benzothiazol-2-yldiazenyl)-2-hydroxyphenyl]-3-(5-hydroxy-2-phenyldiazenylphenyl)-1,3-thiazolidin-4-one (PubChem CID 135428438) has the molecular formula C28H20N6O3S2 and a molecular weight of 552.64 g/mol. Its IUPAC name is 2-[5-(1,3-benzothiazol-2-yldiazenyl)-2-hydroxyphenyl]-3-(5-hydroxy-2-phenyldiazenylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 2-[5-(1,3-benzothiazol-2-yldiazenyl)-2-hydroxyphenyl]-3-(5-hydroxy-2-phenyldiazenylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135428438 |
| Molecular Formula | C28H20N6O3S2 |
| Molecular Weight | 552.64 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | 2-[5-(1,3-benzothiazol-2-yldiazenyl)-2-hydroxyphenyl]-3-(5-hydroxy-2-phenyldiazenylphenyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2cc(/N=N/c3nc4ccccc4s3)ccc2O)N1c1cc(O)ccc1/N=N/c1ccccc1 |
| InChI | InChI=1S/C28H20N6O3S2/c35-19-11-12-21(32-30-17-6-2-1-3-7-17)23(15-19)34-26(37)16-38-27(34)20-14-18(10-13-24(20)36)31-33-28-29-22-8-4-5-9-25(22)39-28/h1-15,27,35-36H,16H2/b32-30+,33-31+ |
| InChIKey | SPBLFDRZIWSGMJ-RRPBDJRISA-N |
| XLogP | 8.32 |
| TPSA | 123.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.64 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|