C39H45N3O7 — CID 136601264
2-hydroxy-5-[2-[2-[2-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl-methylamino]ethoxy]ethoxy]ethoxyiminomethyl]benzamide (PubChem CID 136601264) has the molecular formula C39H45N3O7 and a molecular weight of 667.80 g/mol. Its IUPAC name is 2-hydroxy-5-[2-[2-[2-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl-methylamino]ethoxy]ethoxy]ethoxyiminomethyl]benzamide.
| Compound Name | 2-hydroxy-5-[2-[2-[2-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl-methylamino]ethoxy]ethoxy]ethoxyiminomethyl]benzamide |
|---|---|
| PubChem CID | 136601264 |
| Molecular Formula | C39H45N3O7 |
| Molecular Weight | 667.80 g/mol |
| Exact Mass | 667.33 |
| IUPAC Name | 2-hydroxy-5-[2-[2-[2-[2-[4-[1-(4-hydroxyphenyl)-2-phenylbut-1-enyl]phenoxy]ethyl-methylamino]ethoxy]ethoxy]ethoxyiminomethyl]benzamide |
| SMILES | CCC(=C(c1ccc(O)cc1)c1ccc(OCCN(C)CCOCCOCCON=Cc2ccc(O)c(C(N)=O)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C39H45N3O7/c1-3-35(30-7-5-4-6-8-30)38(31-10-14-33(43)15-11-31)32-12-16-34(17-13-32)48-22-20-42(2)19-21-46-23-24-47-25-26-49-41-28-29-9-18-37(44)36(27-29)39(40)45/h4-18,27-28,43-44H,3,19-26H2,1-2H3,(H2,40,45) |
| InChIKey | BCNDGZDNZMOAHH-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.80 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|