C13H8N2O4 — CID 136717703
3-hydroxy-5,10-dioxidophenazine-5,10-diium-2-carbaldehyde (PubChem CID 136717703) has the molecular formula C13H8N2O4 and a molecular weight of 256.22 g/mol. Its IUPAC name is 3-hydroxy-5,10-dioxidophenazine-5,10-diium-2-carbaldehyde.
| Compound Name | 3-hydroxy-5,10-dioxidophenazine-5,10-diium-2-carbaldehyde |
|---|---|
| PubChem CID | 136717703 |
| Molecular Formula | C13H8N2O4 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 3-hydroxy-5,10-dioxidophenazine-5,10-diium-2-carbaldehyde |
| SMILES | O=Cc1cc2c(cc1O)[n+]([O-])c1ccccc1[n+]2[O-] |
| InChI | InChI=1S/C13H8N2O4/c16-7-8-5-11-12(6-13(8)17)15(19)10-4-2-1-3-9(10)14(11)18/h1-7,17H |
| InChIKey | HXOGCCMBGNLVAE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|