C22H21ClF2N4O3S — CID 138569374
5-[(E)-1-[3-chloro-4-[(3,3-difluoroazetidine-1-carbothioyl)amino]phenoxy]prop-1-enyl]-2-methoxy-4-(methylideneamino)benzamide (PubChem CID 138569374) has the molecular formula C22H21ClF2N4O3S and a molecular weight of 494.95 g/mol. Its IUPAC name is 5-[(E)-1-[3-chloro-4-[(3,3-difluoroazetidine-1-carbothioyl)amino]phenoxy]prop-1-enyl]-2-methoxy-4-(methylideneamino)benzamide.
| Compound Name | 5-[(E)-1-[3-chloro-4-[(3,3-difluoroazetidine-1-carbothioyl)amino]phenoxy]prop-1-enyl]-2-methoxy-4-(methylideneamino)benzamide |
|---|---|
| PubChem CID | 138569374 |
| Molecular Formula | C22H21ClF2N4O3S |
| Molecular Weight | 494.95 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 5-[(E)-1-[3-chloro-4-[(3,3-difluoroazetidine-1-carbothioyl)amino]phenoxy]prop-1-enyl]-2-methoxy-4-(methylideneamino)benzamide |
| SMILES | C=Nc1cc(OC)c(C(N)=O)cc1/C(=C\C)Oc1ccc(NC(=S)N2CC(F)(F)C2)c(Cl)c1 |
| InChI | InChI=1S/C22H21ClF2N4O3S/c1-4-18(13-8-14(20(26)30)19(31-3)9-17(13)27-2)32-12-5-6-16(15(23)7-12)28-21(33)29-10-22(24,25)11-29/h4-9H,2,10-11H2,1,3H3,(H2,26,30)(H,28,33)/b18-4+ |
| InChIKey | WJUDDAWTIPBXQG-JJPRUIFNSA-N |
| XLogP | 4.87 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.95 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|