C30H36N4 — CID 139038082
(7Z,18Z)-2,2,7,8,13,13,18,19-octamethyl-23,24,25,26-tetrazapentacyclo[18.2.1.13,6.19,12.114,17]hexacosa-1(22),3,5,7,9,11,14,16,18,20-decaene (PubChem CID 139038082) has the molecular formula C30H36N4 and a molecular weight of 452.65 g/mol. Its IUPAC name is (7Z,18Z)-2,2,7,8,13,13,18,19-octamethyl-23,24,25,26-tetrazapentacyclo[18.2.1.13,6.19,12.114,17]hexacosa-1(22),3,5,7,9,11,14,16,18,20-decaene.
| Compound Name | (7Z,18Z)-2,2,7,8,13,13,18,19-octamethyl-23,24,25,26-tetrazapentacyclo[18.2.1.13,6.19,12.114,17]hexacosa-1(22),3,5,7,9,11,14,16,18,20-decaene |
|---|---|
| PubChem CID | 139038082 |
| Molecular Formula | C30H36N4 |
| Molecular Weight | 452.65 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | (7Z,18Z)-2,2,7,8,13,13,18,19-octamethyl-23,24,25,26-tetrazapentacyclo[18.2.1.13,6.19,12.114,17]hexacosa-1(22),3,5,7,9,11,14,16,18,20-decaene |
| SMILES | C/C1=C(\C)c2ccc([nH]2)C(C)(C)c2ccc([nH]2)/C(C)=C(/C)c2ccc([nH]2)C(C)(C)c2ccc1[nH]2 |
| InChI | InChI=1S/C30H36N4/c1-17-18(2)22-10-14-26(32-22)30(7,8)28-16-12-24(34-28)20(4)19(3)23-11-15-27(33-23)29(5,6)25-13-9-21(17)31-25/h9-16,31-34H,1-8H3/b18-17-,20-19- |
| InChIKey | CMBWJBUPBKDGFT-RXGVRZIVSA-N |
| XLogP | 7.87 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.65 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |