C19H33Cl2N5O7 — CID 139665984
diethyl 2-acetamido-2-[4-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxybut-1-ynyl]propanedioate;dihydrochloride (PubChem CID 139665984) has the molecular formula C19H33Cl2N5O7 and a molecular weight of 514.41 g/mol. Its IUPAC name is diethyl 2-acetamido-2-[4-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxybut-1-ynyl]propanedioate;dihydrochloride.
| Compound Name | diethyl 2-acetamido-2-[4-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxybut-1-ynyl]propanedioate;dihydrochloride |
|---|---|
| PubChem CID | 139665984 |
| Molecular Formula | C19H33Cl2N5O7 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | diethyl 2-acetamido-2-[4-[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]oxybut-1-ynyl]propanedioate;dihydrochloride |
| SMILES | CCOC(=O)C(C#CCCOC(=O)[C@@H](N)CCCN=C(N)N)(NC(C)=O)C(=O)OCC.Cl.Cl |
| InChI | InChI=1S/C19H31N5O7.2ClH/c1-4-29-16(27)19(24-13(3)25,17(28)30-5-2)10-6-7-12-31-15(26)14(20)9-8-11-23-18(21)22;;/h14H,4-5,7-9,11-12,20H2,1-3H3,(H,24,25)(H4,21,22,23);2*1H/t14-;;/m0../s1 |
| InChIKey | UFDZZJHECSNRAD-UTLKBRERSA-N |
| XLogP | -0.85 |
| TPSA | 198.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|