C16H31N5O4 — CID 141203553
[2-acetyl-2-(diethylamino)-3-oxobutyl] (2S)-2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 141203553) has the molecular formula C16H31N5O4 and a molecular weight of 357.46 g/mol. Its IUPAC name is [2-acetyl-2-(diethylamino)-3-oxobutyl] (2S)-2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | [2-acetyl-2-(diethylamino)-3-oxobutyl] (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 141203553 |
| Molecular Formula | C16H31N5O4 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.24 |
| IUPAC Name | [2-acetyl-2-(diethylamino)-3-oxobutyl] (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | CCN(CC)C(COC(=O)[C@@H](N)CCCN=C(N)N)(C(C)=O)C(C)=O |
| InChI | InChI=1S/C16H31N5O4/c1-5-21(6-2)16(11(3)22,12(4)23)10-25-14(24)13(17)8-7-9-20-15(18)19/h13H,5-10,17H2,1-4H3,(H4,18,19,20)/t13-/m0/s1 |
| InChIKey | FOUCLRVKRPYZCF-ZDUSSCGKSA-N |
| XLogP | -0.83 |
| TPSA | 154.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|