C27H44O4SSi — CID 139802301
methyl (Z)-7-[3-[tert-butyl(dimethyl)silyl]oxy-4-[methoxy(phenylsulfanyl)methyl]cyclopentyl]hept-6-enoate (PubChem CID 139802301) has the molecular formula C27H44O4SSi and a molecular weight of 492.80 g/mol. Its IUPAC name is methyl (Z)-7-[3-[tert-butyl(dimethyl)silyl]oxy-4-[methoxy(phenylsulfanyl)methyl]cyclopentyl]hept-6-enoate.
| Compound Name | methyl (Z)-7-[3-[tert-butyl(dimethyl)silyl]oxy-4-[methoxy(phenylsulfanyl)methyl]cyclopentyl]hept-6-enoate |
|---|---|
| PubChem CID | 139802301 |
| Molecular Formula | C27H44O4SSi |
| Molecular Weight | 492.80 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | methyl (Z)-7-[3-[tert-butyl(dimethyl)silyl]oxy-4-[methoxy(phenylsulfanyl)methyl]cyclopentyl]hept-6-enoate |
| SMILES | COC(=O)CCCC/C=C\C1CC(O[Si](C)(C)C(C)(C)C)C(C(OC)Sc2ccccc2)C1 |
| InChI | InChI=1S/C27H44O4SSi/c1-27(2,3)33(6,7)31-24-20-21(15-11-8-9-14-18-25(28)29-4)19-23(24)26(30-5)32-22-16-12-10-13-17-22/h10-13,15-17,21,23-24,26H,8-9,14,18-20H2,1-7H3/b15-11- |
| InChIKey | FHOFSTFACWLEEF-PTNGSMBKSA-N |
| XLogP | 7.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.80 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|