C16H25ClO13 — CID 141124696
[acetyloxy-[(2R,3R,4R,5R,6R)-3-chloro-6-[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-4,5,6-trihydroxyoxan-2-yl]methyl] acetate (PubChem CID 141124696) has the molecular formula C16H25ClO13 and a molecular weight of 460.82 g/mol. Its IUPAC name is [acetyloxy-[(2R,3R,4R,5R,6R)-3-chloro-6-[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-4,5,6-trihydroxyoxan-2-yl]methyl] acetate.
| Compound Name | [acetyloxy-[(2R,3R,4R,5R,6R)-3-chloro-6-[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-4,5,6-trihydroxyoxan-2-yl]methyl] acetate |
|---|---|
| PubChem CID | 141124696 |
| Molecular Formula | C16H25ClO13 |
| Molecular Weight | 460.82 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | [acetyloxy-[(2R,3R,4R,5R,6R)-3-chloro-6-[(3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]-4,5,6-trihydroxyoxan-2-yl]methyl] acetate |
| SMILES | CC(=O)OC(OC(C)=O)[C@H]1O[C@@](O)(C2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1Cl |
| InChI | InChI=1S/C16H25ClO13/c1-5(20)27-14(28-6(2)21)11-8(17)10(23)13(25)16(26,30-11)15(4-19)12(24)9(22)7(3-18)29-15/h7-14,18-19,22-26H,3-4H2,1-2H3/t7-,8-,9-,10+,11+,12+,13-,15?,16-/m1/s1 |
| InChIKey | FLFSPXSRZLPAFC-QIEGOBGVSA-N |
| XLogP | -4.30 |
| TPSA | 212.67 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.82 |
| LogP ≤ 5 | -4.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|