C40H37BrN4O — CID 141235009
2-[3-[4-(3-bromopentoxy)phenyl]phenyl]-10,15,20-trimethyl-21,23-dihydroporphyrin (PubChem CID 141235009) has the molecular formula C40H37BrN4O and a molecular weight of 669.67 g/mol. Its IUPAC name is 2-[3-[4-(3-bromopentoxy)phenyl]phenyl]-10,15,20-trimethyl-21,23-dihydroporphyrin.
| Compound Name | 2-[3-[4-(3-bromopentoxy)phenyl]phenyl]-10,15,20-trimethyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 141235009 |
| Molecular Formula | C40H37BrN4O |
| Molecular Weight | 669.67 g/mol |
| Exact Mass | 668.22 |
| IUPAC Name | 2-[3-[4-(3-bromopentoxy)phenyl]phenyl]-10,15,20-trimethyl-21,23-dihydroporphyrin |
| SMILES | CCC(Br)CCOc1ccc(-c2cccc(-c3cc4cc5nc(c(C)c6ccc([nH]6)c(C)c6nc(c(C)c3[nH]4)C=C6)C=C5)c2)cc1 |
| InChI | InChI=1S/C40H37BrN4O/c1-5-30(41)19-20-46-33-12-9-27(10-13-33)28-7-6-8-29(21-28)34-23-32-22-31-11-14-35(42-31)24(2)36-15-16-37(44-36)25(3)38-17-18-39(45-38)26(4)40(34)43-32/h6-18,21-23,30,43-44H,5,19-20H2,1-4H3/b31-22-,32-22-,35-24-,36-24-,37-25-,38-25-,39-26-,40-26- |
| InChIKey | PIGFPYVEUWVJGG-GMVVKAESSA-N |
| XLogP | 10.86 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.67 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|