C37H28BrCl3N4O — CID 141235010
2-[3-[4-(3-bromopentoxy)phenyl]phenyl]-10,15,20-trichloro-21,23-dihydroporphyrin (PubChem CID 141235010) has the molecular formula C37H28BrCl3N4O and a molecular weight of 730.92 g/mol. Its IUPAC name is 2-[3-[4-(3-bromopentoxy)phenyl]phenyl]-10,15,20-trichloro-21,23-dihydroporphyrin.
| Compound Name | 2-[3-[4-(3-bromopentoxy)phenyl]phenyl]-10,15,20-trichloro-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 141235010 |
| Molecular Formula | C37H28BrCl3N4O |
| Molecular Weight | 730.92 g/mol |
| Exact Mass | 728.05 |
| IUPAC Name | 2-[3-[4-(3-bromopentoxy)phenyl]phenyl]-10,15,20-trichloro-21,23-dihydroporphyrin |
| SMILES | CCC(Br)CCOc1ccc(-c2cccc(-c3cc4cc5nc(c(Cl)c6ccc([nH]6)c(Cl)c6nc(c(Cl)c3[nH]4)C=C6)C=C5)c2)cc1 |
| InChI | InChI=1S/C37H28BrCl3N4O/c1-2-24(38)16-17-46-27-9-6-21(7-10-27)22-4-3-5-23(18-22)28-20-26-19-25-8-11-29(42-25)34(39)30-12-13-31(44-30)35(40)32-14-15-33(45-32)36(41)37(28)43-26/h3-15,18-20,24,43-44H,2,16-17H2,1H3/b25-19-,26-19-,34-29+,34-30+,35-31+,35-32+,36-33+,37-36+ |
| InChIKey | KOQBNMVPGZCHPU-HSMKIGLRSA-N |
| XLogP | 11.89 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.92 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|