C27H36O6 — CID 141460111
(2S,3R,4R,5R)-10-(2-ethylphenyl)-7-[(2-ethylphenyl)methyl]deca-7,8-diene-1,2,3,4,5,6-hexol (PubChem CID 141460111) has the molecular formula C27H36O6 and a molecular weight of 456.58 g/mol. Its IUPAC name is (2S,3R,4R,5R)-10-(2-ethylphenyl)-7-[(2-ethylphenyl)methyl]deca-7,8-diene-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-10-(2-ethylphenyl)-7-[(2-ethylphenyl)methyl]deca-7,8-diene-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 141460111 |
| Molecular Formula | C27H36O6 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | (2S,3R,4R,5R)-10-(2-ethylphenyl)-7-[(2-ethylphenyl)methyl]deca-7,8-diene-1,2,3,4,5,6-hexol |
| SMILES | CCc1ccccc1CC=C=C(Cc1ccccc1CC)C(O)[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C27H36O6/c1-3-18-10-5-7-12-20(18)14-9-15-22(16-21-13-8-6-11-19(21)4-2)24(30)26(32)27(33)25(31)23(29)17-28/h5-13,23-33H,3-4,14,16-17H2,1-2H3/t15?,23-,24?,25+,26+,27-/m0/s1 |
| InChIKey | QQXQEFMOHOSVKU-FGIWTFSBSA-N |
| XLogP | 1.47 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |