C25H28FN3S — CID 142836425
1-N-[3-(2,3-dihydrothiophen-5-yl)prop-1-en-2-yl]-2-fluoro-5-[(E)-3-(2,3,5,6-tetrahydro-1H-inden-5-yl)prop-2-enimidoyl]benzene-1,4-diamine (PubChem CID 142836425) has the molecular formula C25H28FN3S and a molecular weight of 421.59 g/mol. Its IUPAC name is 1-N-[3-(2,3-dihydrothiophen-5-yl)prop-1-en-2-yl]-2-fluoro-5-[(E)-3-(2,3,5,6-tetrahydro-1H-inden-5-yl)prop-2-enimidoyl]benzene-1,4-diamine.
| Compound Name | 1-N-[3-(2,3-dihydrothiophen-5-yl)prop-1-en-2-yl]-2-fluoro-5-[(E)-3-(2,3,5,6-tetrahydro-1H-inden-5-yl)prop-2-enimidoyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 142836425 |
| Molecular Formula | C25H28FN3S |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 1-N-[3-(2,3-dihydrothiophen-5-yl)prop-1-en-2-yl]-2-fluoro-5-[(E)-3-(2,3,5,6-tetrahydro-1H-inden-5-yl)prop-2-enimidoyl]benzene-1,4-diamine |
| SMILES | [H]/N=C(\C=C\C1C=C2CCCC2=CC1)c1cc(NC(=C)CC2=CCCS2)c(F)cc1N |
| InChI | InChI=1S/C25H28FN3S/c1-16(12-20-6-3-11-30-20)29-25-14-21(24(28)15-22(25)26)23(27)10-8-17-7-9-18-4-2-5-19(18)13-17/h6,8-10,13-15,17,27,29H,1-5,7,11-12,28H2/b10-8+,27-23+ |
| InChIKey | KWDSCLAKMWNIDX-OKDRCJECSA-N |
| XLogP | 6.73 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|