C28H33F5N4O4S2 — CID 142846001
1-cyclopropyl-N-(oxan-2-ylsulfanyl)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide (PubChem CID 142846001) has the molecular formula C28H33F5N4O4S2 and a molecular weight of 648.72 g/mol. Its IUPAC name is 1-cyclopropyl-N-(oxan-2-ylsulfanyl)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-cyclopropyl-N-(oxan-2-ylsulfanyl)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 142846001 |
| Molecular Formula | C28H33F5N4O4S2 |
| Molecular Weight | 648.72 g/mol |
| Exact Mass | 648.19 |
| IUPAC Name | 1-cyclopropyl-N-(oxan-2-ylsulfanyl)-4-[4-[5-(3,3,4,4,4-pentafluorobutyl)pyrazin-2-yl]phenyl]sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NSC1CCCCO1)C1(S(=O)(=O)c2ccc(-c3cnc(CCC(F)(F)C(F)(F)F)cn3)cc2)CCN(C2CC2)CC1 |
| InChI | InChI=1S/C28H33F5N4O4S2/c29-27(30,28(31,32)33)11-10-20-17-35-23(18-34-20)19-4-8-22(9-5-19)43(39,40)26(12-14-37(15-13-26)21-6-7-21)25(38)36-42-24-3-1-2-16-41-24/h4-5,8-9,17-18,21,24H,1-3,6-7,10-16H2,(H,36,38) |
| InChIKey | PMGQSANLMQIULB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.72 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|