C28H23IN4O2S2 — CID 142942975
2-(4-aminophenyl)-7-methyl-1,3-benzothiazol-6-ol;7-iodo-2-(4-methoxyphenyl)-1,3-benzothiazol-6-amine (PubChem CID 142942975) has the molecular formula C28H23IN4O2S2 and a molecular weight of 638.56 g/mol. Its IUPAC name is 2-(4-aminophenyl)-7-methyl-1,3-benzothiazol-6-ol;7-iodo-2-(4-methoxyphenyl)-1,3-benzothiazol-6-amine.
| Compound Name | 2-(4-aminophenyl)-7-methyl-1,3-benzothiazol-6-ol;7-iodo-2-(4-methoxyphenyl)-1,3-benzothiazol-6-amine |
|---|---|
| PubChem CID | 142942975 |
| Molecular Formula | C28H23IN4O2S2 |
| Molecular Weight | 638.56 g/mol |
| Exact Mass | 638.03 |
| IUPAC Name | 2-(4-aminophenyl)-7-methyl-1,3-benzothiazol-6-ol;7-iodo-2-(4-methoxyphenyl)-1,3-benzothiazol-6-amine |
| SMILES | COc1ccc(-c2nc3ccc(N)c(I)c3s2)cc1.Cc1c(O)ccc2nc(-c3ccc(N)cc3)sc12 |
| InChI | InChI=1S/C14H11IN2OS.C14H12N2OS/c1-18-9-4-2-8(3-5-9)14-17-11-7-6-10(16)12(15)13(11)19-14;1-8-12(17)7-6-11-13(8)18-14(16-11)9-2-4-10(15)5-3-9/h2-7H,16H2,1H3;2-7,17H,15H2,1H3 |
| InChIKey | AKGYDIPVLYAYLA-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 107.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.56 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|