About (Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1-pyrrolidin-1-ylprop-2-en-1-one
(Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1-pyrrolidin-1-ylprop-2-en-1-one (PubChem CID 142981454) has the molecular formula C16H17F6N3O
and a molecular weight of 381.32 g/mol. Its IUPAC name is (Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1-pyrrolidin-1-ylprop-2-en-1-one.
Molecular Properties
| Compound Name | (Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1-pyrrolidin-1-ylprop-2-en-1-one |
| PubChem CID | 142981454 |
| Molecular Formula | C16H17F6N3O |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | (Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1-pyrrolidin-1-ylprop-2-en-1-one |
| SMILES | N/C(=C\NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)N1CCCC1 |
| InChI | InChI=1S/C16H17F6N3O/c17-15(18,19)11-5-10(6-12(7-11)16(20,21)22)8-24-9-13(23)14(26)25-3-1-2-4-25/h5-7,9,24H,1-4,8,23H2/b13-9- |
| InChIKey | DWATVMARGUEMCK-LCYFTJDESA-N |
| XLogP | 3.24 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1-pyrrolidin-1-ylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1-pyrrolidin-1-ylprop-2-en-1-one?
The IUPAC name of (Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1-pyrrolidin-1-ylprop-2-en-1-one (CID 142981454) is (Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1-pyrrolidin-1-ylprop-2-en-1-one.
What is the SMILES notation for (Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1-pyrrolidin-1-ylprop-2-en-1-one?
The canonical SMILES for (Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1-pyrrolidin-1-ylprop-2-en-1-one is N/C(=C\NCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C(=O)N1CCCC1.
What is the InChIKey of (Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1-pyrrolidin-1-ylprop-2-en-1-one?
The InChIKey is DWATVMARGUEMCK-LCYFTJDESA-N. The full InChI is InChI=1S/C16H17F6N3O/c17-15(18,19)11-5-10(6-12(7-11)16(20,21)22)8-24-9-13(23)14(26)25-3-1-2-4-25/h5-7,9,24H,1-4,8,23H2/b13-9-.
What are the key properties of (Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1-pyrrolidin-1-ylprop-2-en-1-one?
(Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1-pyrrolidin-1-ylprop-2-en-1-one has a molecular weight of 381.32 g/mol, XLogP of 3.24, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-amino-3-[[3,5-bis(trifluoromethyl)phenyl]methylamino]-1-pyrrolidin-1-ylprop-2-en-1-one is sourced from PubChem (CID 142981454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).