C27H37NO — CID 143071371
bicyclo[2.2.0]hexane;[(3E,6E,8E)-6-methyl-5-methylidene-9-nitrosodeca-1,3,6,8-tetraen-3-yl]benzene;propane (PubChem CID 143071371) has the molecular formula C27H37NO and a molecular weight of 391.60 g/mol. Its IUPAC name is bicyclo[2.2.0]hexane;[(3E,6E,8E)-6-methyl-5-methylidene-9-nitrosodeca-1,3,6,8-tetraen-3-yl]benzene;propane.
| Compound Name | bicyclo[2.2.0]hexane;[(3E,6E,8E)-6-methyl-5-methylidene-9-nitrosodeca-1,3,6,8-tetraen-3-yl]benzene;propane |
|---|---|
| PubChem CID | 143071371 |
| Molecular Formula | C27H37NO |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.29 |
| IUPAC Name | bicyclo[2.2.0]hexane;[(3E,6E,8E)-6-methyl-5-methylidene-9-nitrosodeca-1,3,6,8-tetraen-3-yl]benzene;propane |
| SMILES | C1CC2CCC12.C=C/C(=C\C(=C)/C(C)=C/C=C(\C)N=O)c1ccccc1.CCC |
| InChI | InChI=1S/C18H19NO.C6H10.C3H8/c1-5-17(18-9-7-6-8-10-18)13-15(3)14(2)11-12-16(4)19-20;1-2-6-4-3-5(1)6;1-3-2/h5-13H,1,3H2,2,4H3;5-6H,1-4H2;3H2,1-2H3/b14-11+,16-12+,17-13+;; |
| InChIKey | YFOADJOJRSUTMT-AEBBORKISA-N |
| XLogP | 8.65 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|