C8H15BO3 — CID 143329930
(3E,5Z)-hepta-1,3,5-trien-4-ol;methylboronic acid (PubChem CID 143329930) has the molecular formula C8H15BO3 and a molecular weight of 170.02 g/mol. Its IUPAC name is (3E,5Z)-hepta-1,3,5-trien-4-ol;methylboronic acid.
| Compound Name | (3E,5Z)-hepta-1,3,5-trien-4-ol;methylboronic acid |
|---|---|
| PubChem CID | 143329930 |
| Molecular Formula | C8H15BO3 |
| Molecular Weight | 170.02 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (3E,5Z)-hepta-1,3,5-trien-4-ol;methylboronic acid |
| SMILES | C=C/C=C(O)\C=C/C.CB(O)O |
| InChI | InChI=1S/C7H10O.CH5BO2/c1-3-5-7(8)6-4-2;1-2(3)4/h3-6,8H,1H2,2H3;3-4H,1H3/b6-4-,7-5+; |
| InChIKey | BIYLZVQKAIRTTA-ZMVRXXEHSA-N |
| XLogP | 1.28 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.02 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|