C17H19S+ — CID 143609520
cyclohexa-1,5-dien-1-yl-[(3E)-penta-1,3-dien-3-yl]-phenylsulfanium (PubChem CID 143609520) has the molecular formula C17H19S+ and a molecular weight of 255.41 g/mol. Its IUPAC name is cyclohexa-1,5-dien-1-yl-[(3E)-penta-1,3-dien-3-yl]-phenylsulfanium.
| Compound Name | cyclohexa-1,5-dien-1-yl-[(3E)-penta-1,3-dien-3-yl]-phenylsulfanium |
|---|---|
| PubChem CID | 143609520 |
| Molecular Formula | C17H19S+ |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | cyclohexa-1,5-dien-1-yl-[(3E)-penta-1,3-dien-3-yl]-phenylsulfanium |
| SMILES | C=C/C(=C\C)[S+](C1=CCCC=C1)c1ccccc1 |
| InChI | InChI=1S/C17H19S/c1-3-15(4-2)18(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h3-5,7-9,11-14H,1,6,10H2,2H3/q+1/b15-4+ |
| InChIKey | NJGXKFLBJALHMX-SYZQJQIISA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|