C14H16N2O — CID 143728772
4,5-dihydro-1,3-oxazol-2-amine;1-methylnaphthalene (PubChem CID 143728772) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is 4,5-dihydro-1,3-oxazol-2-amine;1-methylnaphthalene.
| Compound Name | 4,5-dihydro-1,3-oxazol-2-amine;1-methylnaphthalene |
|---|---|
| PubChem CID | 143728772 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 4,5-dihydro-1,3-oxazol-2-amine;1-methylnaphthalene |
| SMILES | Cc1cccc2ccccc12.NC1=NCCO1 |
| InChI | InChI=1S/C11H10.C3H6N2O/c1-9-5-4-7-10-6-2-3-8-11(9)10;4-3-5-1-2-6-3/h2-8H,1H3;1-2H2,(H2,4,5) |
| InChIKey | PGTIYOAIHJVQGL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |