C27H33F3O — CID 143772569
4-[(3Z,7Z)-9-ethoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-2-fluoro-1-[(E)-5-methylhex-2-en-2-yl]cyclohexa-1,3-diene (PubChem CID 143772569) has the molecular formula C27H33F3O and a molecular weight of 430.55 g/mol. Its IUPAC name is 4-[(3Z,7Z)-9-ethoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-2-fluoro-1-[(E)-5-methylhex-2-en-2-yl]cyclohexa-1,3-diene.
| Compound Name | 4-[(3Z,7Z)-9-ethoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-2-fluoro-1-[(E)-5-methylhex-2-en-2-yl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143772569 |
| Molecular Formula | C27H33F3O |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 4-[(3Z,7Z)-9-ethoxy-7,8-difluoro-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]-2-fluoro-1-[(E)-5-methylhex-2-en-2-yl]cyclohexa-1,3-diene |
| SMILES | C=C(/C=C\C(=C)C1=CC(F)=C(/C(C)=C/CC(C)C)CC1)C(=C)/C(F)=C(\F)C(=C)OCC |
| InChI | InChI=1S/C27H33F3O/c1-9-31-22(8)27(30)26(29)21(7)18(4)12-13-19(5)23-14-15-24(25(28)16-23)20(6)11-10-17(2)3/h11-13,16-17H,4-5,7-10,14-15H2,1-3,6H3/b13-12-,20-11+,27-26- |
| InChIKey | OZTXVKXPHXPHEQ-GXIJOQSASA-N |
| XLogP | 8.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|