C7H15Cl2N2O4P — CID 143849441
2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinane-4,4-diol (PubChem CID 143849441) has the molecular formula C7H15Cl2N2O4P and a molecular weight of 293.09 g/mol. Its IUPAC name is 2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinane-4,4-diol.
| Compound Name | 2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinane-4,4-diol |
|---|---|
| PubChem CID | 143849441 |
| Molecular Formula | C7H15Cl2N2O4P |
| Molecular Weight | 293.09 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2λ5-oxazaphosphinane-4,4-diol |
| SMILES | O=P1(N(CCCl)CCCl)NC(O)(O)CCO1 |
| InChI | InChI=1S/C7H15Cl2N2O4P/c8-2-4-11(5-3-9)16(14)10-7(12,13)1-6-15-16/h12-13H,1-6H2,(H,10,14) |
| InChIKey | DELFIBVKIGJFAO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.09 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|