C18H29NS — CID 143899852
3,7-dihydro-2H-cyclohepta[f][1,3]benzothiazole;ethane (PubChem CID 143899852) has the molecular formula C18H29NS and a molecular weight of 291.50 g/mol. Its IUPAC name is 3,7-dihydro-2H-cyclohepta[f][1,3]benzothiazole;ethane.
| Compound Name | 3,7-dihydro-2H-cyclohepta[f][1,3]benzothiazole;ethane |
|---|---|
| PubChem CID | 143899852 |
| Molecular Formula | C18H29NS |
| Molecular Weight | 291.50 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 3,7-dihydro-2H-cyclohepta[f][1,3]benzothiazole;ethane |
| SMILES | C1=Cc2cc3c(cc2C=CC1)SCN3.CC.CC.CC |
| InChI | InChI=1S/C12H11NS.3C2H6/c1-2-4-9-6-11-12(14-8-13-11)7-10(9)5-3-1;3*1-2/h2-7,13H,1,8H2;3*1-2H3 |
| InChIKey | SYTPCULLXXPHAS-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.50 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |