C13H15N3O2S — CID 144530672
N,4-dimethylaniline;5-methylidene-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 144530672) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is N,4-dimethylaniline;5-methylidene-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | N,4-dimethylaniline;5-methylidene-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 144530672 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N,4-dimethylaniline;5-methylidene-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C=C1C(=O)NC(=S)NC1=O.CNc1ccc(C)cc1 |
| InChI | InChI=1S/C8H11N.C5H4N2O2S/c1-7-3-5-8(9-2)6-4-7;1-2-3(8)6-5(10)7-4(2)9/h3-6,9H,1-2H3;1H2,(H2,6,7,8,9,10) |
| InChIKey | UVXIYNVLTYZULL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|