C42H35N — CID 144969105
(E)-N-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-3-(10-methylanthracen-9-yl)-1-phenanthren-9-ylbut-2-en-1-imine (PubChem CID 144969105) has the molecular formula C42H35N and a molecular weight of 553.75 g/mol. Its IUPAC name is (E)-N-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-3-(10-methylanthracen-9-yl)-1-phenanthren-9-ylbut-2-en-1-imine.
| Compound Name | (E)-N-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-3-(10-methylanthracen-9-yl)-1-phenanthren-9-ylbut-2-en-1-imine |
|---|---|
| PubChem CID | 144969105 |
| Molecular Formula | C42H35N |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | (E)-N-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-3-(10-methylanthracen-9-yl)-1-phenanthren-9-ylbut-2-en-1-imine |
| SMILES | C=C/C(=C\C=C/C)C(=C)/N=C(/C=C(\C)c1c2ccccc2c(C)c2ccccc12)c1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C42H35N/c1-6-8-17-31(7-2)30(5)43-41(40-27-32-18-9-10-21-35(32)36-22-13-14-23-37(36)40)26-28(3)42-38-24-15-11-19-33(38)29(4)34-20-12-16-25-39(34)42/h6-27H,2,5H2,1,3-4H3/b8-6-,28-26+,31-17+,43-41+ |
| InChIKey | QUYSYQVZSMSAHK-DWSUSRODSA-N |
| XLogP | 11.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|