C34H34N2 — CID 156706370
N'-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-N-(1-phenylethylidene)-6-propan-2-yl-9H-fluorene-1-carboximidamide (PubChem CID 156706370) has the molecular formula C34H34N2 and a molecular weight of 470.66 g/mol. Its IUPAC name is N'-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-N-(1-phenylethylidene)-6-propan-2-yl-9H-fluorene-1-carboximidamide.
| Compound Name | N'-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-N-(1-phenylethylidene)-6-propan-2-yl-9H-fluorene-1-carboximidamide |
|---|---|
| PubChem CID | 156706370 |
| Molecular Formula | C34H34N2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | N'-[(3E,5Z)-3-ethenylhepta-1,3,5-trien-2-yl]-N-(1-phenylethylidene)-6-propan-2-yl-9H-fluorene-1-carboximidamide |
| SMILES | C=C/C(=C\C=C/C)C(=C)/N=C(\N=C(/C)c1ccccc1)c1cccc2c1Cc1ccc(C(C)C)cc1-2 |
| InChI | InChI=1S/C34H34N2/c1-7-9-14-26(8-2)24(5)35-34(36-25(6)27-15-11-10-12-16-27)31-18-13-17-30-32-21-28(23(3)4)19-20-29(32)22-33(30)31/h7-21,23H,2,5,22H2,1,3-4,6H3/b9-7-,26-14+,35-34+,36-25+ |
| InChIKey | BCUHSYQDQRBAIH-ZJQGJIPOSA-N |
| XLogP | 8.84 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|